| Name | Rosolic acid |
| Synonyms | Rosolic acid 4,4'-Dihydroxy-3-methylfuchsone 4-(BIS(P-HYDROXYPHENYL)METHYLENE)-2-METHYL-5-CYCLOHEXADIEN-1-ONE 4-(Bis(4-hydroxyphenyl)methylene)-2-methyl-2,5-cyclohexadien-1-one 2,5-Cyclohexadien-1-one, 4-[bis(4-hydroxyphenyl)methylene]-2-methyl- 4-[(4-hydroxy-3-methyl-phenyl)-(4-hydroxyphenyl)methylidene]cyclohexa-2,5-dien-1-one |
| CAS | 633-00-1 |
| InChI | InChI=1/C20H16O3/c1-13-12-16(6-11-19(13)23)20(14-2-7-17(21)8-3-14)15-4-9-18(22)10-5-15/h2-12,21-22H,1H3 |
| Molecular Formula | C20H16O3 |
| Molar Mass | 304.34 |
| Density | 1.275±0.06 g/cm3(Predicted) |
| Melting Point | >350℃ |
| Boling Point | 544.8±50.0 °C(Predicted) |
| Appearance | Deep red crystal |
| pKa | 8.98±0.30(Predicted) |
| Storage Condition | Room Temprature |
| Sensitive | Sensitive to light |
| Refractive Index | 1.67 |
| MDL | MFCD00001624 |
| Use | Acid-base indicator, pH6 · 8 (yellow) ~ 8 · 0 (red). Qualitative reagents for carbon dioxide in water for beverages can also be used to distinguish human milk from cow's milk. Dye intermediates. |